C13H25N5O — CID 106228225
4-[4-(1-aminopropyl)triazol-1-yl]-N,N-diethylbutanamide (PubChem CID 106228225) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-[4-(1-aminopropyl)triazol-1-yl]-N,N-diethylbutanamide.
| Compound Name | 4-[4-(1-aminopropyl)triazol-1-yl]-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 106228225 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 4-[4-(1-aminopropyl)triazol-1-yl]-N,N-diethylbutanamide |
| SMILES | CCC(N)c1cn(CCCC(=O)N(CC)CC)nn1 |
| InChI | InChI=1S/C13H25N5O/c1-4-11(14)12-10-18(16-15-12)9-7-8-13(19)17(5-2)6-3/h10-11H,4-9,14H2,1-3H3 |
| InChIKey | BUIMKEDJNHYNLJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |