C13H15Cl2N5O — CID 106228283
2-[4-(1-aminopropyl)triazol-1-yl]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 106228283) has the molecular formula C13H15Cl2N5O and a molecular weight of 328.20 g/mol. Its IUPAC name is 2-[4-(1-aminopropyl)triazol-1-yl]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[4-(1-aminopropyl)triazol-1-yl]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 106228283 |
| Molecular Formula | C13H15Cl2N5O |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-[4-(1-aminopropyl)triazol-1-yl]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | CCC(N)c1cn(CC(=O)Nc2cccc(Cl)c2Cl)nn1 |
| InChI | InChI=1S/C13H15Cl2N5O/c1-2-9(16)11-6-20(19-18-11)7-12(21)17-10-5-3-4-8(14)13(10)15/h3-6,9H,2,7,16H2,1H3,(H,17,21) |
| InChIKey | UJPPVWKOMUXNKS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |