About 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide
2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide (PubChem CID 106228668) has the molecular formula C13H25N5O
and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide |
| PubChem CID | 106228668 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide |
| SMILES | CCCC(N)c1cn(C(C)C(=O)N(CC)CC)nn1 |
| InChI | InChI=1S/C13H25N5O/c1-5-8-11(14)12-9-18(16-15-12)10(4)13(19)17(6-2)7-3/h9-11H,5-8,14H2,1-4H3 |
| InChIKey | CDGMEVSJVIWFHG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide?
The IUPAC name of 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide (CID 106228668) is 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide.
What is the SMILES notation for 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide?
The canonical SMILES for 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide is CCCC(N)c1cn(C(C)C(=O)N(CC)CC)nn1.
What is the InChIKey of 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide?
The InChIKey is CDGMEVSJVIWFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N5O/c1-5-8-11(14)12-9-18(16-15-12)10(4)13(19)17(6-2)7-3/h9-11H,5-8,14H2,1-4H3.
What are the key properties of 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide?
2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide has a molecular weight of 267.38 g/mol, XLogP of 1.51, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-aminobutyl)triazol-1-yl]-N,N-diethylpropanamide is sourced from PubChem (CID 106228668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).