C22H29F3N4O2 — CID 10622877
2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 10622877) has the molecular formula C22H29F3N4O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 10622877 |
| Molecular Formula | C22H29F3N4O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1C2CCCN2C(=O)CN1CCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H29F3N4O2/c23-22(24,25)17-5-3-6-18(15-17)27-13-11-26(12-14-27)8-1-2-9-28-16-20(30)29-10-4-7-19(29)21(28)31/h3,5-6,15,19H,1-2,4,7-14,16H2 |
| InChIKey | IBBDKVXHADYTFU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|