C13H22N2O — CID 106230204
N-pent-1-yn-3-yl-3-propylpyrrolidine-3-carboxamide (PubChem CID 106230204) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-pent-1-yn-3-yl-3-propylpyrrolidine-3-carboxamide.
| Compound Name | N-pent-1-yn-3-yl-3-propylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106230204 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-pent-1-yn-3-yl-3-propylpyrrolidine-3-carboxamide |
| SMILES | C#CC(CC)NC(=O)C1(CCC)CCNC1 |
| InChI | InChI=1S/C13H22N2O/c1-4-7-13(8-9-14-10-13)12(16)15-11(5-2)6-3/h2,11,14H,4,6-10H2,1,3H3,(H,15,16) |
| InChIKey | PRKJOCUKBROSAR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|