C9H15N3O2 — CID 106230441
2-amino-N-[2-oxo-2-(pent-1-yn-3-ylamino)ethyl]acetamide (PubChem CID 106230441) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-(pent-1-yn-3-ylamino)ethyl]acetamide.
| Compound Name | 2-amino-N-[2-oxo-2-(pent-1-yn-3-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 106230441 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-amino-N-[2-oxo-2-(pent-1-yn-3-ylamino)ethyl]acetamide |
| SMILES | C#CC(CC)NC(=O)CNC(=O)CN |
| InChI | InChI=1S/C9H15N3O2/c1-3-7(4-2)12-9(14)6-11-8(13)5-10/h1,7H,4-6,10H2,2H3,(H,11,13)(H,12,14) |
| InChIKey | SALZJWOSVBFLJU-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|