C26H26N4O3 — CID 10623068
1-(1-butyl-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl)-3-phenylurea (PubChem CID 10623068) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-(1-butyl-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl)-3-phenylurea.
| Compound Name | 1-(1-butyl-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl)-3-phenylurea |
|---|---|
| PubChem CID | 10623068 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 1-(1-butyl-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl)-3-phenylurea |
| SMILES | CCCCN1C(=O)C(NC(=O)Nc2ccccc2)C(=O)N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H26N4O3/c1-2-3-18-29-21-16-10-11-17-22(21)30(20-14-8-5-9-15-20)25(32)23(24(29)31)28-26(33)27-19-12-6-4-7-13-19/h4-17,23H,2-3,18H2,1H3,(H2,27,28,33) |
| InChIKey | DJEFKQCWHPGNSD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|