C16H19N3 — CID 106230839
2-(hex-1-yn-3-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 106230839) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-(hex-1-yn-3-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-(hex-1-yn-3-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 106230839 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-(hex-1-yn-3-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | C#CC(CCC)Nc1nc2c(cc1C#N)CCCC2 |
| InChI | InChI=1S/C16H19N3/c1-3-7-14(4-2)18-16-13(11-17)10-12-8-5-6-9-15(12)19-16/h2,10,14H,3,5-9H2,1H3,(H,18,19) |
| InChIKey | WOXQEKKSUYHGRY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|