C15H15NO3 — CID 106231848
3-[(pent-1-yn-3-ylamino)methyl]-1-benzofuran-2-carboxylic acid (PubChem CID 106231848) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-[(pent-1-yn-3-ylamino)methyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-[(pent-1-yn-3-ylamino)methyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 106231848 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-[(pent-1-yn-3-ylamino)methyl]-1-benzofuran-2-carboxylic acid |
| SMILES | C#CC(CC)NCc1c(C(=O)O)oc2ccccc12 |
| InChI | InChI=1S/C15H15NO3/c1-3-10(4-2)16-9-12-11-7-5-6-8-13(11)19-14(12)15(17)18/h1,5-8,10,16H,4,9H2,2H3,(H,17,18) |
| InChIKey | KAHDFQLYGRQAHA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|