C10H15N3O4 — CID 106232197
(2S)-4-amino-4-oxo-2-(pent-1-yn-3-ylcarbamoylamino)butanoic acid (PubChem CID 106232197) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is (2S)-4-amino-4-oxo-2-(pent-1-yn-3-ylcarbamoylamino)butanoic acid.
| Compound Name | (2S)-4-amino-4-oxo-2-(pent-1-yn-3-ylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 106232197 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (2S)-4-amino-4-oxo-2-(pent-1-yn-3-ylcarbamoylamino)butanoic acid |
| SMILES | C#CC(CC)NC(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H15N3O4/c1-3-6(4-2)12-10(17)13-7(9(15)16)5-8(11)14/h1,6-7H,4-5H2,2H3,(H2,11,14)(H,15,16)(H2,12,13,17)/t6?,7-/m0/s1 |
| InChIKey | WXXJIXNIFANTNM-MLWJPKLSSA-N |
| XLogP | -0.97 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|