C16H18N2O3 — CID 106232456
1-(hex-1-yn-3-ylcarbamoyl)-2,3-dihydroindole-5-carboxylic acid (PubChem CID 106232456) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-(hex-1-yn-3-ylcarbamoyl)-2,3-dihydroindole-5-carboxylic acid.
| Compound Name | 1-(hex-1-yn-3-ylcarbamoyl)-2,3-dihydroindole-5-carboxylic acid |
|---|---|
| PubChem CID | 106232456 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-(hex-1-yn-3-ylcarbamoyl)-2,3-dihydroindole-5-carboxylic acid |
| SMILES | C#CC(CCC)NC(=O)N1CCc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C16H18N2O3/c1-3-5-13(4-2)17-16(21)18-9-8-11-10-12(15(19)20)6-7-14(11)18/h2,6-7,10,13H,3,5,8-9H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | FVQRKEBWOQWORL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|