C15H24N2O3 — CID 106232462
3-[1-(hex-1-yn-3-ylcarbamoyl)piperidin-3-yl]propanoic acid (PubChem CID 106232462) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-[1-(hex-1-yn-3-ylcarbamoyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-(hex-1-yn-3-ylcarbamoyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 106232462 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3-[1-(hex-1-yn-3-ylcarbamoyl)piperidin-3-yl]propanoic acid |
| SMILES | C#CC(CCC)NC(=O)N1CCCC(CCC(=O)O)C1 |
| InChI | InChI=1S/C15H24N2O3/c1-3-6-13(4-2)16-15(20)17-10-5-7-12(11-17)8-9-14(18)19/h2,12-13H,3,5-11H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | SWJMZCKQCQXNOR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|