C9H13ClN2O2 — CID 106232693
2-chloro-N-(hex-1-yn-3-ylcarbamoyl)acetamide (PubChem CID 106232693) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 2-chloro-N-(hex-1-yn-3-ylcarbamoyl)acetamide.
| Compound Name | 2-chloro-N-(hex-1-yn-3-ylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 106232693 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-chloro-N-(hex-1-yn-3-ylcarbamoyl)acetamide |
| SMILES | C#CC(CCC)NC(=O)NC(=O)CCl |
| InChI | InChI=1S/C9H13ClN2O2/c1-3-5-7(4-2)11-9(14)12-8(13)6-10/h2,7H,3,5-6H2,1H3,(H2,11,12,13,14) |
| InChIKey | YRGHZUDXJPYTND-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|