C12H14N2O3S — CID 106232865
ethyl 4-(pent-1-yn-3-ylcarbamoyl)-1,3-thiazole-2-carboxylate (PubChem CID 106232865) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is ethyl 4-(pent-1-yn-3-ylcarbamoyl)-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 4-(pent-1-yn-3-ylcarbamoyl)-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 106232865 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | ethyl 4-(pent-1-yn-3-ylcarbamoyl)-1,3-thiazole-2-carboxylate |
| SMILES | C#CC(CC)NC(=O)c1csc(C(=O)OCC)n1 |
| InChI | InChI=1S/C12H14N2O3S/c1-4-8(5-2)13-10(15)9-7-18-11(14-9)12(16)17-6-3/h1,7-8H,5-6H2,2-3H3,(H,13,15) |
| InChIKey | RZDLUWZUPAHKJN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|