C25H25N3O5 — CID 10623300
(1R,12S)-3,4-dimethyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one (PubChem CID 10623300) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is (1R,12S)-3,4-dimethyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one.
| Compound Name | (1R,12S)-3,4-dimethyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
|---|---|
| PubChem CID | 10623300 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (1R,12S)-3,4-dimethyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
| SMILES | COc1cc2cc(C(=O)N3C[C@H]4C[C@@]45C3=CC(=O)c3[nH]c(C)c(C)c35)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C25H25N3O5/c1-11-12(2)26-21-16(29)8-18-25(19(11)21)9-14(25)10-28(18)24(30)15-6-13-7-17(31-3)22(32-4)23(33-5)20(13)27-15/h6-8,14,26-27H,9-10H2,1-5H3/t14-,25+/m1/s1 |
| InChIKey | LNGIPIMCPBTODD-PWECECGKSA-N |
| XLogP | 3.63 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |