C28H20N2O2S — CID 10623357
2-(2,4,8a-trimethyl-7-oxo-8,8-diphenylthieno[2,3-f][2]benzofuran-5-ylidene)propanedinitrile (PubChem CID 10623357) has the molecular formula C28H20N2O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-(2,4,8a-trimethyl-7-oxo-8,8-diphenylthieno[2,3-f][2]benzofuran-5-ylidene)propanedinitrile.
| Compound Name | 2-(2,4,8a-trimethyl-7-oxo-8,8-diphenylthieno[2,3-f][2]benzofuran-5-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 10623357 |
| Molecular Formula | C28H20N2O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-(2,4,8a-trimethyl-7-oxo-8,8-diphenylthieno[2,3-f][2]benzofuran-5-ylidene)propanedinitrile |
| SMILES | CC1=CC2=C(C)C3=C(C(=O)OC3=C(C#N)C#N)C(c3ccccc3)(c3ccccc3)C2(C)S1 |
| InChI | InChI=1S/C28H20N2O2S/c1-17-14-22-18(2)23-24(26(31)32-25(23)19(15-29)16-30)28(27(22,3)33-17,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-14H,1-3H3 |
| InChIKey | CHVNOAQDXJXSEM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|