About 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol
1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol (PubChem CID 10623381) has the molecular formula C28H33ClN2O
and a molecular weight of 449.04 g/mol. Its IUPAC name is 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol |
| PubChem CID | 10623381 |
| Molecular Formula | C28H33ClN2O |
| Molecular Weight | 449.04 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol |
| SMILES | NCC(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33ClN2O/c29-26-14-12-25(13-15-26)28(32)17-20-31(21-18-28)19-7-16-27(22-30,23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-6,8-15,32H,7,16-22,30H2 |
| InChIKey | MPEGRCNLPCPVSF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.04 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol?
The IUPAC name of 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol (CID 10623381) is 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol.
What is the SMILES notation for 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol?
The canonical SMILES for 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol is NCC(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol?
The InChIKey is MPEGRCNLPCPVSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33ClN2O/c29-26-14-12-25(13-15-26)28(32)17-20-31(21-18-28)19-7-16-27(22-30,23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-6,8-15,32H,7,16-22,30H2.
What are the key properties of 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol?
1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol has a molecular weight of 449.04 g/mol, XLogP of 5.35, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-4,4-diphenylpentyl)-4-(4-chlorophenyl)piperidin-4-ol is sourced from PubChem (CID 10623381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).