2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid

C7H14N2O5S — CID 106234815

IUPAC2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid
SMILESNC(=O)CCCCNS(=O)(=O)CC(=O)O
InChIInChI=1S/C7H14N2O5S/c8-6(10)3-1-2-4-9-15(13,14)5-7(11)12/h9H,1-5H2,(H2,8,10)(H,11,12)
InChIKeyVBVOAXVVVLXNMQ-UHFFFAOYSA-N
MW238.26 g/mol
LogP-1.35
Rot. Bonds8

About 2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid

2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid (PubChem CID 106234815) has the molecular formula C7H14N2O5S and a molecular weight of 238.26 g/mol. Its IUPAC name is 2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid.

Molecular Properties

Compound Name2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid
PubChem CID106234815
Molecular FormulaC7H14N2O5S
Molecular Weight238.26 g/mol
Exact Mass238.06
IUPAC Name2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid
SMILESNC(=O)CCCCNS(=O)(=O)CC(=O)O
InChIInChI=1S/C7H14N2O5S/c8-6(10)3-1-2-4-9-15(13,14)5-7(11)12/h9H,1-5H2,(H2,8,10)(H,11,12)
InChIKeyVBVOAXVVVLXNMQ-UHFFFAOYSA-N
XLogP-1.35
TPSA126.56 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.26
LogP ≤ 5-1.35
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[(4-amino-4-oxobutyl)sulfamoyl]propanoic acid
CID 60864275
2-(4-hydroxypentylsulfamoyl)acetic acid
CID 106120521
8-(ethylsulfonylamino)octanoic acid
CID 21103229
5-aminopentanoic acid;5-(ethylsulfonylamino)pentanoic acid
CID 161088986
4-(sulfamoylamino)butanamide
CID 112684755
6-(methylsulfonylmethylsulfonylamino)hexanoic acid
CID 82839698
5-(2-cyclopropylpropylsulfonylamino)pentanamide
CID 154770138
7-(butylsulfonylamino)heptanoic acid
CID 24704780
11-(octylsulfonylamino)undecanoic acid
CID 4605614
4-(chloromethylsulfonylamino)butanoic acid
CID 63664973
34-amino-34-oxotetratriacontanoic acid
CID 139682719
24-amino-24-oxotetracosanoic acid
CID 139682769

Frequently Asked Questions

What is the IUPAC name of 2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid?
The IUPAC name of 2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid (CID 106234815) is 2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid.
What is the SMILES notation for 2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid?
The canonical SMILES for 2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid is NC(=O)CCCCNS(=O)(=O)CC(=O)O.
What is the InChIKey of 2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid?
The InChIKey is VBVOAXVVVLXNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O5S/c8-6(10)3-1-2-4-9-15(13,14)5-7(11)12/h9H,1-5H2,(H2,8,10)(H,11,12).
What are the key properties of 2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid?
2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid has a molecular weight of 238.26 g/mol, XLogP of -1.35, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-5-oxopentyl)sulfamoyl]acetic acid is sourced from PubChem (CID 106234815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).