C26H33NO4Si — CID 10623485
3-[(4R)-7-[tert-butyl(diphenyl)silyl]oxyhept-1-en-4-yl]-1,3-oxazolidine-2,4-dione (PubChem CID 10623485) has the molecular formula C26H33NO4Si and a molecular weight of 451.64 g/mol. Its IUPAC name is 3-[(4R)-7-[tert-butyl(diphenyl)silyl]oxyhept-1-en-4-yl]-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-[(4R)-7-[tert-butyl(diphenyl)silyl]oxyhept-1-en-4-yl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 10623485 |
| Molecular Formula | C26H33NO4Si |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 3-[(4R)-7-[tert-butyl(diphenyl)silyl]oxyhept-1-en-4-yl]-1,3-oxazolidine-2,4-dione |
| SMILES | C=CC[C@@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)COC1=O |
| InChI | InChI=1S/C26H33NO4Si/c1-5-13-21(27-24(28)20-30-25(27)29)14-12-19-31-32(26(2,3)4,22-15-8-6-9-16-22)23-17-10-7-11-18-23/h5-11,15-18,21H,1,12-14,19-20H2,2-4H3/t21-/m0/s1 |
| InChIKey | YUHOFELWMLKGLN-NRFANRHFSA-N |
| XLogP | 4.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|