C23H26N4O4S — CID 10623602
(E)-1-(4-acetylpiperazin-1-yl)-3-[4-[2-(dimethylamino)phenyl]sulfanyl-3-nitrophenyl]prop-2-en-1-one (PubChem CID 10623602) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is (E)-1-(4-acetylpiperazin-1-yl)-3-[4-[2-(dimethylamino)phenyl]sulfanyl-3-nitrophenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-acetylpiperazin-1-yl)-3-[4-[2-(dimethylamino)phenyl]sulfanyl-3-nitrophenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10623602 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (E)-1-(4-acetylpiperazin-1-yl)-3-[4-[2-(dimethylamino)phenyl]sulfanyl-3-nitrophenyl]prop-2-en-1-one |
| SMILES | CC(=O)N1CCN(C(=O)/C=C/c2ccc(Sc3ccccc3N(C)C)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C23H26N4O4S/c1-17(28)25-12-14-26(15-13-25)23(29)11-9-18-8-10-22(20(16-18)27(30)31)32-21-7-5-4-6-19(21)24(2)3/h4-11,16H,12-15H2,1-3H3/b11-9+ |
| InChIKey | JHAUMXZLLWOYET-PKNBQFBNSA-N |
| XLogP | 3.52 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|