C13H25N3O3 — CID 106236621
N-[2-(2-amino-2-oxoethoxy)ethyl]-2-methyl-2-piperidin-3-ylpropanamide (PubChem CID 106236621) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethoxy)ethyl]-2-methyl-2-piperidin-3-ylpropanamide.
| Compound Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-2-methyl-2-piperidin-3-ylpropanamide |
|---|---|
| PubChem CID | 106236621 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-2-methyl-2-piperidin-3-ylpropanamide |
| SMILES | CC(C)(C(=O)NCCOCC(N)=O)C1CCCNC1 |
| InChI | InChI=1S/C13H25N3O3/c1-13(2,10-4-3-5-15-8-10)12(18)16-6-7-19-9-11(14)17/h10,15H,3-9H2,1-2H3,(H2,14,17)(H,16,18) |
| InChIKey | QRGSXIQICZPHBY-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|