C7H12N6O3 — CID 106236686
3-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 106236686) has the molecular formula C7H12N6O3 and a molecular weight of 228.21 g/mol. Its IUPAC name is 3-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 106236686 |
| Molecular Formula | C7H12N6O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | NC(=O)COCCNC(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C7H12N6O3/c8-4(14)3-16-2-1-10-6(15)5-11-7(9)13-12-5/h1-3H2,(H2,8,14)(H,10,15)(H3,9,11,12,13) |
| InChIKey | AQPFRXPYHJRIBQ-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 149.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|