C20H28N2O2S4 — CID 10623702
4-hydroxy-3-[3-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-3-yl)-2,4,5,6-tetramethylphenyl]-4,5-dimethyl-1,3-thiazolidine-2-thione (PubChem CID 10623702) has the molecular formula C20H28N2O2S4 and a molecular weight of 456.72 g/mol. Its IUPAC name is 4-hydroxy-3-[3-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-3-yl)-2,4,5,6-tetramethylphenyl]-4,5-dimethyl-1,3-thiazolidine-2-thione.
| Compound Name | 4-hydroxy-3-[3-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-3-yl)-2,4,5,6-tetramethylphenyl]-4,5-dimethyl-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 10623702 |
| Molecular Formula | C20H28N2O2S4 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 4-hydroxy-3-[3-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-3-yl)-2,4,5,6-tetramethylphenyl]-4,5-dimethyl-1,3-thiazolidine-2-thione |
| SMILES | Cc1c(C)c(N2C(=S)SC(C)C2(C)O)c(C)c(N2C(=S)SC(C)C2(C)O)c1C |
| InChI | InChI=1S/C20H28N2O2S4/c1-9-10(2)15(21-17(25)27-13(5)19(21,7)23)12(4)16(11(9)3)22-18(26)28-14(6)20(22,8)24/h13-14,23-24H,1-8H3 |
| InChIKey | IXRBBNSVJAKHBM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|