C21H31NO6S2 — CID 10623724
diethyl (2S)-2-[[5-(3-acetylsulfanylpropyl)-3-ethylthiophene-2-carbonyl]amino]pentanedioate (PubChem CID 10623724) has the molecular formula C21H31NO6S2 and a molecular weight of 457.61 g/mol. Its IUPAC name is diethyl (2S)-2-[[5-(3-acetylsulfanylpropyl)-3-ethylthiophene-2-carbonyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[5-(3-acetylsulfanylpropyl)-3-ethylthiophene-2-carbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 10623724 |
| Molecular Formula | C21H31NO6S2 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | diethyl (2S)-2-[[5-(3-acetylsulfanylpropyl)-3-ethylthiophene-2-carbonyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1sc(CCCSC(C)=O)cc1CC)C(=O)OCC |
| InChI | InChI=1S/C21H31NO6S2/c1-5-15-13-16(9-8-12-29-14(4)23)30-19(15)20(25)22-17(21(26)28-7-3)10-11-18(24)27-6-2/h13,17H,5-12H2,1-4H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | PIRFBTSPWWGZTB-KRWDZBQOSA-N |
| XLogP | 3.53 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|