C26H32N4O2Si — CID 10623851
5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-ethyl-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (PubChem CID 10623851) has the molecular formula C26H32N4O2Si and a molecular weight of 460.65 g/mol. Its IUPAC name is 5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-ethyl-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one.
| Compound Name | 5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-ethyl-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 10623851 |
| Molecular Formula | C26H32N4O2Si |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-ethyl-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| SMILES | CCN1c2ncccc2C(=O)N(C)c2ccc(-c3ccc(O[Si](C)(C)C(C)(C)C)cc3)nc21 |
| InChI | InChI=1S/C26H32N4O2Si/c1-8-30-23-20(10-9-17-27-23)25(31)29(5)22-16-15-21(28-24(22)30)18-11-13-19(14-12-18)32-33(6,7)26(2,3)4/h9-17H,8H2,1-7H3 |
| InChIKey | IVGMIUWGBQGIQT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|