C8H11F3N4OS — CID 106238655
5-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]pentanamide (PubChem CID 106238655) has the molecular formula C8H11F3N4OS and a molecular weight of 268.26 g/mol. Its IUPAC name is 5-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]pentanamide.
| Compound Name | 5-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]pentanamide |
|---|---|
| PubChem CID | 106238655 |
| Molecular Formula | C8H11F3N4OS |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 5-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]pentanamide |
| SMILES | NC(=O)CCCCNc1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C8H11F3N4OS/c9-8(10,11)6-14-15-7(17-6)13-4-2-1-3-5(12)16/h1-4H2,(H2,12,16)(H,13,15) |
| InChIKey | CWCQDFYISUSWEM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|