C24H23N5O3S — CID 10623890
2-(5-carbamimidoyl-1H-indol-3-yl)-N-methyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide (PubChem CID 10623890) has the molecular formula C24H23N5O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is 2-(5-carbamimidoyl-1H-indol-3-yl)-N-methyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide.
| Compound Name | 2-(5-carbamimidoyl-1H-indol-3-yl)-N-methyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 10623890 |
| Molecular Formula | C24H23N5O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 2-(5-carbamimidoyl-1H-indol-3-yl)-N-methyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc2[nH]cc(CC(=O)N(C)c3ccc(-c4ccccc4S(N)(=O)=O)cc3)c2c1 |
| InChI | InChI=1S/C24H23N5O3S/c1-29(23(30)13-17-14-28-21-11-8-16(24(25)26)12-20(17)21)18-9-6-15(7-10-18)19-4-2-3-5-22(19)33(27,31)32/h2-12,14,28H,13H2,1H3,(H3,25,26)(H2,27,31,32) |
| InChIKey | IDEBRVLRSCFDGV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 146.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|