C25H38O6Si — CID 10623938
(6R,7R,15S)-15-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one (PubChem CID 10623938) has the molecular formula C25H38O6Si and a molecular weight of 462.66 g/mol. Its IUPAC name is (6R,7R,15S)-15-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one.
| Compound Name | (6R,7R,15S)-15-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
|---|---|
| PubChem CID | 10623938 |
| Molecular Formula | C25H38O6Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | (6R,7R,15S)-15-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](c1ccccc1)[C@@H]1O[C@]2(CCCCO2)[C@@]2(CCCCO2)OC1=O |
| InChI | InChI=1S/C25H38O6Si/c1-23(2,3)32(4,5)31-20(19-13-7-6-8-14-19)21-22(26)30-25(16-10-12-18-28-25)24(29-21)15-9-11-17-27-24/h6-8,13-14,20-21H,9-12,15-18H2,1-5H3/t20-,21-,24+,25+/m0/s1 |
| InChIKey | RNQUUXIRTGASOM-KXTAGPOFSA-N |
| XLogP | 5.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|