C12H15FN4O3 — CID 106240092
2-[2-(2-amino-5-fluoro-6-methoxybenzimidazol-1-yl)ethoxy]acetamide (PubChem CID 106240092) has the molecular formula C12H15FN4O3 and a molecular weight of 282.28 g/mol. Its IUPAC name is 2-[2-(2-amino-5-fluoro-6-methoxybenzimidazol-1-yl)ethoxy]acetamide.
| Compound Name | 2-[2-(2-amino-5-fluoro-6-methoxybenzimidazol-1-yl)ethoxy]acetamide |
|---|---|
| PubChem CID | 106240092 |
| Molecular Formula | C12H15FN4O3 |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-[2-(2-amino-5-fluoro-6-methoxybenzimidazol-1-yl)ethoxy]acetamide |
| SMILES | COc1cc2c(cc1F)nc(N)n2CCOCC(N)=O |
| InChI | InChI=1S/C12H15FN4O3/c1-19-10-5-9-8(4-7(10)13)16-12(15)17(9)2-3-20-6-11(14)18/h4-5H,2-3,6H2,1H3,(H2,14,18)(H2,15,16) |
| InChIKey | YAXXHYKKCACCES-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|