C13H15N3O4 — CID 106240755
1-[2-(2-amino-2-oxoethoxy)ethyl]-2-methylbenzimidazole-4-carboxylic acid (PubChem CID 106240755) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-[2-(2-amino-2-oxoethoxy)ethyl]-2-methylbenzimidazole-4-carboxylic acid.
| Compound Name | 1-[2-(2-amino-2-oxoethoxy)ethyl]-2-methylbenzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106240755 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-[2-(2-amino-2-oxoethoxy)ethyl]-2-methylbenzimidazole-4-carboxylic acid |
| SMILES | Cc1nc2c(C(=O)O)cccc2n1CCOCC(N)=O |
| InChI | InChI=1S/C13H15N3O4/c1-8-15-12-9(13(18)19)3-2-4-10(12)16(8)5-6-20-7-11(14)17/h2-4H,5-7H2,1H3,(H2,14,17)(H,18,19) |
| InChIKey | OCTNWIUNUQGRTJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|