C14H22N4O3 — CID 106240894
2-[2-[[3-[1-(methylamino)ethyl]phenyl]carbamoylamino]ethoxy]acetamide (PubChem CID 106240894) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-[2-[[3-[1-(methylamino)ethyl]phenyl]carbamoylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[[3-[1-(methylamino)ethyl]phenyl]carbamoylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106240894 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[2-[[3-[1-(methylamino)ethyl]phenyl]carbamoylamino]ethoxy]acetamide |
| SMILES | CNC(C)c1cccc(NC(=O)NCCOCC(N)=O)c1 |
| InChI | InChI=1S/C14H22N4O3/c1-10(16-2)11-4-3-5-12(8-11)18-14(20)17-6-7-21-9-13(15)19/h3-5,8,10,16H,6-7,9H2,1-2H3,(H2,15,19)(H2,17,18,20) |
| InChIKey | LSDOUTAWTZNYEK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|