C26H48O5Si — CID 10624146
ethyl (E)-4-[(2R,3S,6R,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-8-yl]-2-methylbut-2-enoate (PubChem CID 10624146) has the molecular formula C26H48O5Si and a molecular weight of 468.75 g/mol. Its IUPAC name is ethyl (E)-4-[(2R,3S,6R,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-8-yl]-2-methylbut-2-enoate.
| Compound Name | ethyl (E)-4-[(2R,3S,6R,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-8-yl]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 10624146 |
| Molecular Formula | C26H48O5Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | ethyl (E)-4-[(2R,3S,6R,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-8-yl]-2-methylbut-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/C[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@]2(CC[C@H](C)[C@@H](C(C)C)O2)O1 |
| InChI | InChI=1S/C26H48O5Si/c1-11-28-24(27)20(5)12-13-21-16-22(31-32(9,10)25(6,7)8)17-26(29-21)15-14-19(4)23(30-26)18(2)3/h12,18-19,21-23H,11,13-17H2,1-10H3/b20-12+/t19-,21+,22-,23+,26+/m0/s1 |
| InChIKey | WKXGJLONQZMCJX-FEQLCFFMSA-N |
| XLogP | 6.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|