C11H18N4O — CID 106241556
5-[[6-(methylamino)-2-pyridinyl]amino]pentanamide (PubChem CID 106241556) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 5-[[6-(methylamino)-2-pyridinyl]amino]pentanamide.
| Compound Name | 5-[[6-(methylamino)-2-pyridinyl]amino]pentanamide |
|---|---|
| PubChem CID | 106241556 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 5-[[6-(methylamino)-2-pyridinyl]amino]pentanamide |
| SMILES | CNc1cccc(NCCCCC(N)=O)n1 |
| InChI | InChI=1S/C11H18N4O/c1-13-10-6-4-7-11(15-10)14-8-3-2-5-9(12)16/h4,6-7H,2-3,5,8H2,1H3,(H2,12,16)(H2,13,14,15) |
| InChIKey | SBTNNDNFHFIOHN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|