About 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide
5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide (PubChem CID 106242101) has the molecular formula C8H14N4OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide.
Molecular Properties
| Compound Name | 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide |
| PubChem CID | 106242101 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide |
| SMILES | NC(=O)CCCCNc1cc(N)ns1 |
| InChI | InChI=1S/C8H14N4OS/c9-6-5-8(14-12-6)11-4-2-1-3-7(10)13/h5,11H,1-4H2,(H2,9,12)(H2,10,13) |
| InChIKey | WRATZSWLKJNAGI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide?
The IUPAC name of 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide (CID 106242101) is 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide.
What is the SMILES notation for 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide?
The canonical SMILES for 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide is NC(=O)CCCCNc1cc(N)ns1.
What is the InChIKey of 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide?
The InChIKey is WRATZSWLKJNAGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4OS/c9-6-5-8(14-12-6)11-4-2-1-3-7(10)13/h5,11H,1-4H2,(H2,9,12)(H2,10,13).
What are the key properties of 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide?
5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide has a molecular weight of 214.29 g/mol, XLogP of 0.79, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-amino-1,2-thiazol-5-yl)amino]pentanamide is sourced from PubChem (CID 106242101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).