C27H27ClN4S — CID 10624368
4-[2-(4-butylphenyl)ethyl]-7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 10624368) has the molecular formula C27H27ClN4S and a molecular weight of 475.06 g/mol. Its IUPAC name is 4-[2-(4-butylphenyl)ethyl]-7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 4-[2-(4-butylphenyl)ethyl]-7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 10624368 |
| Molecular Formula | C27H27ClN4S |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 4-[2-(4-butylphenyl)ethyl]-7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | CCCCc1ccc(CCc2cc3c(s2)-n2c(C)nnc2CN=C3c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C27H27ClN4S/c1-3-4-7-19-10-12-20(13-11-19)14-15-21-16-23-26(22-8-5-6-9-24(22)28)29-17-25-31-30-18(2)32(25)27(23)33-21/h5-6,8-13,16H,3-4,7,14-15,17H2,1-2H3 |
| InChIKey | KYAWBGDNKNBOJF-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |