C12H22N4O2 — CID 106244415
4-methoxy-1-N-(6-propan-2-yloxypyrazin-2-yl)butane-1,3-diamine (PubChem CID 106244415) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-methoxy-1-N-(6-propan-2-yloxypyrazin-2-yl)butane-1,3-diamine.
| Compound Name | 4-methoxy-1-N-(6-propan-2-yloxypyrazin-2-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 106244415 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-methoxy-1-N-(6-propan-2-yloxypyrazin-2-yl)butane-1,3-diamine |
| SMILES | COCC(N)CCNc1cncc(OC(C)C)n1 |
| InChI | InChI=1S/C12H22N4O2/c1-9(2)18-12-7-14-6-11(16-12)15-5-4-10(13)8-17-3/h6-7,9-10H,4-5,8,13H2,1-3H3,(H,15,16) |
| InChIKey | LIYVSVWDKUZSLQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |