C12H17F3N2O — CID 106244540
4-methoxy-1-N-[2-(trifluoromethyl)phenyl]butane-1,3-diamine (PubChem CID 106244540) has the molecular formula C12H17F3N2O and a molecular weight of 262.28 g/mol. Its IUPAC name is 4-methoxy-1-N-[2-(trifluoromethyl)phenyl]butane-1,3-diamine.
| Compound Name | 4-methoxy-1-N-[2-(trifluoromethyl)phenyl]butane-1,3-diamine |
|---|---|
| PubChem CID | 106244540 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-methoxy-1-N-[2-(trifluoromethyl)phenyl]butane-1,3-diamine |
| SMILES | COCC(N)CCNc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O/c1-18-8-9(16)6-7-17-11-5-3-2-4-10(11)12(13,14)15/h2-5,9,17H,6-8,16H2,1H3 |
| InChIKey | XXVXYMPDFCRATD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |