C10H14BrN3O2 — CID 106244827
N-(3-bromo-4-methoxybutyl)pyrimidine-5-carboxamide (PubChem CID 106244827) has the molecular formula C10H14BrN3O2 and a molecular weight of 288.14 g/mol. Its IUPAC name is N-(3-bromo-4-methoxybutyl)pyrimidine-5-carboxamide.
| Compound Name | N-(3-bromo-4-methoxybutyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 106244827 |
| Molecular Formula | C10H14BrN3O2 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N-(3-bromo-4-methoxybutyl)pyrimidine-5-carboxamide |
| SMILES | COCC(Br)CCNC(=O)c1cncnc1 |
| InChI | InChI=1S/C10H14BrN3O2/c1-16-6-9(11)2-3-14-10(15)8-4-12-7-13-5-8/h4-5,7,9H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | WDWJOHKCEBGWJW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|