C10H14BrNO2S — CID 106245034
N-(3-bromo-4-methoxybutyl)thiophene-2-carboxamide (PubChem CID 106245034) has the molecular formula C10H14BrNO2S and a molecular weight of 292.20 g/mol. Its IUPAC name is N-(3-bromo-4-methoxybutyl)thiophene-2-carboxamide.
| Compound Name | N-(3-bromo-4-methoxybutyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106245034 |
| Molecular Formula | C10H14BrNO2S |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | N-(3-bromo-4-methoxybutyl)thiophene-2-carboxamide |
| SMILES | COCC(Br)CCNC(=O)c1cccs1 |
| InChI | InChI=1S/C10H14BrNO2S/c1-14-7-8(11)4-5-12-10(13)9-3-2-6-15-9/h2-3,6,8H,4-5,7H2,1H3,(H,12,13) |
| InChIKey | KQBILMOHMZWLMP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|