About tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate
tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate (PubChem CID 10624608) has the molecular formula C32H35NO3
and a molecular weight of 481.64 g/mol. Its IUPAC name is tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate.
Molecular Properties
| Compound Name | tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate |
| PubChem CID | 10624608 |
| Molecular Formula | C32H35NO3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate |
| SMILES | CC(C)C(=O)/C=C/C[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H35NO3/c1-22(2)29(34)21-13-20-28(30(35)36-31(3,4)5)33-32(23-14-7-6-8-15-23)26-18-11-9-16-24(26)25-17-10-12-19-27(25)32/h6-19,21-22,28,33H,20H2,1-5H3/b21-13+/t28-/m0/s1 |
| InChIKey | ZLYKVQULUHASJO-PPOGSYTESA-N |
| XLogP | 6.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate?
The IUPAC name of tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate (CID 10624608) is tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate.
What is the SMILES notation for tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate?
The canonical SMILES for tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate is CC(C)C(=O)/C=C/C[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate?
The InChIKey is ZLYKVQULUHASJO-PPOGSYTESA-N. The full InChI is InChI=1S/C32H35NO3/c1-22(2)29(34)21-13-20-28(30(35)36-31(3,4)5)33-32(23-14-7-6-8-15-23)26-18-11-9-16-24(26)25-17-10-12-19-27(25)32/h6-19,21-22,28,33H,20H2,1-5H3/b21-13+/t28-/m0/s1.
What are the key properties of tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate?
tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate has a molecular weight of 481.64 g/mol, XLogP of 6.43, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E,2S)-7-methyl-6-oxo-2-[(9-phenylfluoren-9-yl)amino]oct-4-enoate is sourced from PubChem (CID 10624608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).