C24H22N2O5S2 — CID 10624647
2-sulfanylidene-4-thiophen-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-5,6-dihydrobenzo[f]isoquinoline-1-carbonitrile (PubChem CID 10624647) has the molecular formula C24H22N2O5S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-sulfanylidene-4-thiophen-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-5,6-dihydrobenzo[f]isoquinoline-1-carbonitrile.
| Compound Name | 2-sulfanylidene-4-thiophen-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-5,6-dihydrobenzo[f]isoquinoline-1-carbonitrile |
|---|---|
| PubChem CID | 10624647 |
| Molecular Formula | C24H22N2O5S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 2-sulfanylidene-4-thiophen-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-5,6-dihydrobenzo[f]isoquinoline-1-carbonitrile |
| SMILES | N#Cc1c2c(c(-c3cccs3)n([C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)c1=S)CCc1ccccc1-2 |
| InChI | InChI=1S/C24H22N2O5S2/c25-10-15-18-13-5-2-1-4-12(13)7-8-14(18)19(17-6-3-9-33-17)26(24(15)32)23-22(30)21(29)20(28)16(11-27)31-23/h1-6,9,16,20-23,27-30H,7-8,11H2/t16-,20+,21+,22-,23-/m1/s1 |
| InChIKey | SIMXXVPFGGJRMS-HWLDZIHSSA-N |
| XLogP | 2.56 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|