C21H24O9S2 — CID 10624720
[(2R,4aR,6S,7R,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate (PubChem CID 10624720) has the molecular formula C21H24O9S2 and a molecular weight of 484.55 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate.
| Compound Name | [(2R,4aR,6S,7R,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 10624720 |
| Molecular Formula | C21H24O9S2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | [(2R,4aR,6S,7R,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H](S(=O)(=O)c2ccccc2)[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C21H24O9S2/c1-26-21-18(30-31(2,22)23)19(32(24,25)15-11-7-4-8-12-15)17-16(28-21)13-27-20(29-17)14-9-5-3-6-10-14/h3-12,16-21H,13H2,1-2H3/t16-,17-,18+,19-,20-,21+/m1/s1 |
| InChIKey | MUOISZCNQYAHCR-RZTRGMPVSA-N |
| XLogP | 1.66 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|