C29H28O7 — CID 10624856
[(1R,2S,7S,8R,9S,17S)-7-hydroxy-1,17-dimethyl-12-methylidene-14,16-dioxo-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-en-8-yl] naphthalene-1-carboxylate (PubChem CID 10624856) has the molecular formula C29H28O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is [(1R,2S,7S,8R,9S,17S)-7-hydroxy-1,17-dimethyl-12-methylidene-14,16-dioxo-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-en-8-yl] naphthalene-1-carboxylate.
| Compound Name | [(1R,2S,7S,8R,9S,17S)-7-hydroxy-1,17-dimethyl-12-methylidene-14,16-dioxo-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-en-8-yl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10624856 |
| Molecular Formula | C29H28O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [(1R,2S,7S,8R,9S,17S)-7-hydroxy-1,17-dimethyl-12-methylidene-14,16-dioxo-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-en-8-yl] naphthalene-1-carboxylate |
| SMILES | C=C1OC(=O)C2=C1O[C@@H]1[C@@H](OC(=O)c3cccc4ccccc34)[C@]3(O)CCCC[C@H]3[C@](C)(C2=O)[C@@H]1C |
| InChI | InChI=1S/C29H28O7/c1-15-22-25(36-26(31)19-12-8-10-17-9-4-5-11-18(17)19)29(33)14-7-6-13-20(29)28(15,3)24(30)21-23(35-22)16(2)34-27(21)32/h4-5,8-12,15,20,22,25,33H,2,6-7,13-14H2,1,3H3/t15-,20+,22+,25-,28-,29+/m1/s1 |
| InChIKey | ZQYGQFHKQVESJG-WFPIARJKSA-N |
| XLogP | 4.24 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|