C12H19F3N4O2 — CID 106248639
4-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-methoxybutan-2-ol (PubChem CID 106248639) has the molecular formula C12H19F3N4O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is 4-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-methoxybutan-2-ol.
| Compound Name | 4-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 106248639 |
| Molecular Formula | C12H19F3N4O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-methoxybutan-2-ol |
| SMILES | CCNc1cc(NCCC(O)COC)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H19F3N4O2/c1-3-16-9-6-10(17-5-4-8(20)7-21-2)19-11(18-9)12(13,14)15/h6,8,20H,3-5,7H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | NRIYFMXESCFYCQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |