C26H26BrN3O2 — CID 10624963
2-bromo-3-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-phenylpropanoic acid (PubChem CID 10624963) has the molecular formula C26H26BrN3O2 and a molecular weight of 492.42 g/mol. Its IUPAC name is 2-bromo-3-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-phenylpropanoic acid.
| Compound Name | 2-bromo-3-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10624963 |
| Molecular Formula | C26H26BrN3O2 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-bromo-3-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-3-phenylpropanoic acid |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(C(c2ccccc2)C(Br)C(=O)O)cc1 |
| InChI | InChI=1S/C26H26BrN3O2/c1-4-21-29-24-16(2)14-17(3)28-25(24)30(21)15-18-10-12-20(13-11-18)22(23(27)26(31)32)19-8-6-5-7-9-19/h5-14,22-23H,4,15H2,1-3H3,(H,31,32) |
| InChIKey | ULXYLNLYZUYLJG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|