C30H52O5 — CID 10624982
(3S,4R,5S,6S)-6-[(3S,8R,9R,13R,14S,17R)-3-hydroxy-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3,4,5-tetrol (PubChem CID 10624982) has the molecular formula C30H52O5 and a molecular weight of 492.74 g/mol. Its IUPAC name is (3S,4R,5S,6S)-6-[(3S,8R,9R,13R,14S,17R)-3-hydroxy-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3,4,5-tetrol.
| Compound Name | (3S,4R,5S,6S)-6-[(3S,8R,9R,13R,14S,17R)-3-hydroxy-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 10624982 |
| Molecular Formula | C30H52O5 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | (3S,4R,5S,6S)-6-[(3S,8R,9R,13R,14S,17R)-3-hydroxy-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3,4,5-tetrol |
| SMILES | C[C@H]([C@H](O)[C@@H](O)[C@H](O)C(C)(C)O)[C@H]1CC[C@@]2(C)[C@@H]3CC=C4C(CC[C@H](O)C4(C)C)[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C30H52O5/c1-17(23(32)24(33)25(34)27(4,5)35)18-13-14-30(8)21-11-9-19-20(10-12-22(31)26(19,2)3)28(21,6)15-16-29(18,30)7/h9,17-18,20-25,31-35H,10-16H2,1-8H3/t17-,18+,20?,21+,22-,23-,24+,25-,28-,29+,30-/m0/s1 |
| InChIKey | ZCFHDTCVGYMUTF-OQRBPXPFSA-N |
| XLogP | 4.44 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|