C23H27ClN2O6S — CID 10625036
4-(4-phenyl-2,6-dipropylpyridin-1-ium-1-yl)benzenesulfonamide perchlorate (PubChem CID 10625036) has the molecular formula C23H27ClN2O6S and a molecular weight of 495.00 g/mol. Its IUPAC name is 4-(4-phenyl-2,6-dipropylpyridin-1-ium-1-yl)benzenesulfonamide perchlorate.
| Compound Name | 4-(4-phenyl-2,6-dipropylpyridin-1-ium-1-yl)benzenesulfonamide perchlorate |
|---|---|
| PubChem CID | 10625036 |
| Molecular Formula | C23H27ClN2O6S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 4-(4-phenyl-2,6-dipropylpyridin-1-ium-1-yl)benzenesulfonamide perchlorate |
| SMILES | CCCc1cc(-c2ccccc2)cc(CCC)[n+]1-c1ccc(S(N)(=O)=O)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H27N2O2S.ClHO4/c1-3-8-21-16-19(18-10-6-5-7-11-18)17-22(9-4-2)25(21)20-12-14-23(15-13-20)28(24,26)27;2-1(3,4)5/h5-7,10-17H,3-4,8-9H2,1-2H3,(H2,24,26,27);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | LJCMDNIZHPWQBZ-UHFFFAOYSA-M |
| XLogP | -0.57 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|