C25H36N8O3 — CID 10625087
(2S)-N-[(2S)-5-(diaminomethylideneamino)-1-(1-methylimidazol-2-yl)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 10625087) has the molecular formula C25H36N8O3 and a molecular weight of 496.62 g/mol. Its IUPAC name is (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-(1-methylimidazol-2-yl)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-(1-methylimidazol-2-yl)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10625087 |
| Molecular Formula | C25H36N8O3 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-(1-methylimidazol-2-yl)-1-oxopentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)c1nccn1C |
| InChI | InChI=1S/C25H36N8O3/c1-28-19(16-17-8-4-3-5-9-17)24(36)33-14-7-11-20(33)23(35)31-18(10-6-12-30-25(26)27)21(34)22-29-13-15-32(22)2/h3-5,8-9,13,15,18-20,28H,6-7,10-12,14,16H2,1-2H3,(H,31,35)(H4,26,27,30)/t18-,19+,20-/m0/s1 |
| InChIKey | AZDLSQYZJKUEPP-ZCNNSNEGSA-N |
| XLogP | -0.04 |
| TPSA | 160.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|