C12H21F3N2S — CID 106251300
5,5-diethyl-N-(4,4,4-trifluorobutyl)-4,6-dihydro-1,3-thiazin-2-amine (PubChem CID 106251300) has the molecular formula C12H21F3N2S and a molecular weight of 282.38 g/mol. Its IUPAC name is 5,5-diethyl-N-(4,4,4-trifluorobutyl)-4,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | 5,5-diethyl-N-(4,4,4-trifluorobutyl)-4,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 106251300 |
| Molecular Formula | C12H21F3N2S |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 5,5-diethyl-N-(4,4,4-trifluorobutyl)-4,6-dihydro-1,3-thiazin-2-amine |
| SMILES | CCC1(CC)CN=C(NCCCC(F)(F)F)SC1 |
| InChI | InChI=1S/C12H21F3N2S/c1-3-11(4-2)8-17-10(18-9-11)16-7-5-6-12(13,14)15/h3-9H2,1-2H3,(H,16,17) |
| InChIKey | GNAPJBOUVSLHDT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|