C13H23F3N2S — CID 106251303
5,5-diethyl-N-(5,5,5-trifluoropentyl)-4,6-dihydro-1,3-thiazin-2-amine (PubChem CID 106251303) has the molecular formula C13H23F3N2S and a molecular weight of 296.40 g/mol. Its IUPAC name is 5,5-diethyl-N-(5,5,5-trifluoropentyl)-4,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | 5,5-diethyl-N-(5,5,5-trifluoropentyl)-4,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 106251303 |
| Molecular Formula | C13H23F3N2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 5,5-diethyl-N-(5,5,5-trifluoropentyl)-4,6-dihydro-1,3-thiazin-2-amine |
| SMILES | CCC1(CC)CN=C(NCCCCC(F)(F)F)SC1 |
| InChI | InChI=1S/C13H23F3N2S/c1-3-12(4-2)9-18-11(19-10-12)17-8-6-5-7-13(14,15)16/h3-10H2,1-2H3,(H,17,18) |
| InChIKey | LHFVOKAQFVSAFQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|